C36H32N2O4 — CID 10144171
1-N,3-N-dibenzyl-1-N,3-N-bis(4-methoxyphenyl)benzene-1,3-dicarboxamide (PubChem CID 10144171) has the molecular formula C36H32N2O4 and a molecular weight of 556.66 g/mol. Its IUPAC name is 1-N,3-N-dibenzyl-1-N,3-N-bis(4-methoxyphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-dibenzyl-1-N,3-N-bis(4-methoxyphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 10144171 |
| Molecular Formula | C36H32N2O4 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | 1-N,3-N-dibenzyl-1-N,3-N-bis(4-methoxyphenyl)benzene-1,3-dicarboxamide |
| SMILES | COc1ccc(N(Cc2ccccc2)C(=O)c2cccc(C(=O)N(Cc3ccccc3)c3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C36H32N2O4/c1-41-33-20-16-31(17-21-33)37(25-27-10-5-3-6-11-27)35(39)29-14-9-15-30(24-29)36(40)38(26-28-12-7-4-8-13-28)32-18-22-34(42-2)23-19-32/h3-24H,25-26H2,1-2H3 |
| InChIKey | YQAAAOUXJPXAIV-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |