C24H22N4O2 — CID 134012327
N-benzyl-N-(4-methoxyphenyl)-4-(1,2,4-triazol-1-ylmethyl)benzamide (PubChem CID 134012327) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is N-benzyl-N-(4-methoxyphenyl)-4-(1,2,4-triazol-1-ylmethyl)benzamide.
| Compound Name | N-benzyl-N-(4-methoxyphenyl)-4-(1,2,4-triazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 134012327 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-benzyl-N-(4-methoxyphenyl)-4-(1,2,4-triazol-1-ylmethyl)benzamide |
| SMILES | COc1ccc(N(Cc2ccccc2)C(=O)c2ccc(Cn3cncn3)cc2)cc1 |
| InChI | InChI=1S/C24H22N4O2/c1-30-23-13-11-22(12-14-23)28(16-19-5-3-2-4-6-19)24(29)21-9-7-20(8-10-21)15-27-18-25-17-26-27/h2-14,17-18H,15-16H2,1H3 |
| InChIKey | HOIWFBOUJPIGIH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |