C27H28N2O3 — CID 46052545
N-benzyl-N-[4-[2-(cyclopropylmethylamino)-2-oxoethyl]phenyl]-3-methoxybenzamide (PubChem CID 46052545) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-benzyl-N-[4-[2-(cyclopropylmethylamino)-2-oxoethyl]phenyl]-3-methoxybenzamide.
| Compound Name | N-benzyl-N-[4-[2-(cyclopropylmethylamino)-2-oxoethyl]phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 46052545 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-benzyl-N-[4-[2-(cyclopropylmethylamino)-2-oxoethyl]phenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N(Cc2ccccc2)c2ccc(CC(=O)NCC3CC3)cc2)c1 |
| InChI | InChI=1S/C27H28N2O3/c1-32-25-9-5-8-23(17-25)27(31)29(19-22-6-3-2-4-7-22)24-14-12-20(13-15-24)16-26(30)28-18-21-10-11-21/h2-9,12-15,17,21H,10-11,16,18-19H2,1H3,(H,28,30) |
| InChIKey | IZRLZZAWLRNMBV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |