C31H34N2O5 — CID 93291351
ethyl (3S)-1-[2-[4-[benzyl-(3-methoxybenzoyl)amino]phenyl]acetyl]piperidine-3-carboxylate (PubChem CID 93291351) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is ethyl (3S)-1-[2-[4-[benzyl-(3-methoxybenzoyl)amino]phenyl]acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-[4-[benzyl-(3-methoxybenzoyl)amino]phenyl]acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 93291351 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | ethyl (3S)-1-[2-[4-[benzyl-(3-methoxybenzoyl)amino]phenyl]acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)Cc2ccc(N(Cc3ccccc3)C(=O)c3cccc(OC)c3)cc2)C1 |
| InChI | InChI=1S/C31H34N2O5/c1-3-38-31(36)26-12-8-18-32(22-26)29(34)19-23-14-16-27(17-15-23)33(21-24-9-5-4-6-10-24)30(35)25-11-7-13-28(20-25)37-2/h4-7,9-11,13-17,20,26H,3,8,12,18-19,21-22H2,1-2H3/t26-/m0/s1 |
| InChIKey | HQACLSDALDAPFY-SANMLTNESA-N |
| XLogP | 4.89 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |