C26H32N2O4 — CID 93329378
ethyl (3S)-1-[2-[4-[benzyl(propanoyl)amino]phenyl]acetyl]piperidine-3-carboxylate (PubChem CID 93329378) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is ethyl (3S)-1-[2-[4-[benzyl(propanoyl)amino]phenyl]acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-[4-[benzyl(propanoyl)amino]phenyl]acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 93329378 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | ethyl (3S)-1-[2-[4-[benzyl(propanoyl)amino]phenyl]acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)Cc2ccc(N(Cc3ccccc3)C(=O)CC)cc2)C1 |
| InChI | InChI=1S/C26H32N2O4/c1-3-24(29)28(18-21-9-6-5-7-10-21)23-14-12-20(13-15-23)17-25(30)27-16-8-11-22(19-27)26(31)32-4-2/h5-7,9-10,12-15,22H,3-4,8,11,16-19H2,1-2H3/t22-/m0/s1 |
| InChIKey | PJTDSOBQBBAKTG-QFIPXVFZSA-N |
| XLogP | 3.97 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |