C26H32N2O5 — CID 42852925
ethyl 1-[2-[4-[benzyl-(2-methoxyacetyl)amino]phenyl]acetyl]piperidine-3-carboxylate (PubChem CID 42852925) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is ethyl 1-[2-[4-[benzyl-(2-methoxyacetyl)amino]phenyl]acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[4-[benzyl-(2-methoxyacetyl)amino]phenyl]acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42852925 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | ethyl 1-[2-[4-[benzyl-(2-methoxyacetyl)amino]phenyl]acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)Cc2ccc(N(Cc3ccccc3)C(=O)COC)cc2)C1 |
| InChI | InChI=1S/C26H32N2O5/c1-3-33-26(31)22-10-7-15-27(18-22)24(29)16-20-11-13-23(14-12-20)28(25(30)19-32-2)17-21-8-5-4-6-9-21/h4-6,8-9,11-14,22H,3,7,10,15-19H2,1-2H3 |
| InChIKey | ZGJFJBAXOUWYRJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |