C26H25FN2O2 — CID 46056800
N-[3-[2-(cyclopropylmethylamino)-2-oxoethyl]phenyl]-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 46056800) has the molecular formula C26H25FN2O2 and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[3-[2-(cyclopropylmethylamino)-2-oxoethyl]phenyl]-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | N-[3-[2-(cyclopropylmethylamino)-2-oxoethyl]phenyl]-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 46056800 |
| Molecular Formula | C26H25FN2O2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-[3-[2-(cyclopropylmethylamino)-2-oxoethyl]phenyl]-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(Cc1cccc(N(Cc2ccc(F)cc2)C(=O)c2ccccc2)c1)NCC1CC1 |
| InChI | InChI=1S/C26H25FN2O2/c27-23-13-11-20(12-14-23)18-29(26(31)22-6-2-1-3-7-22)24-8-4-5-21(15-24)16-25(30)28-17-19-9-10-19/h1-8,11-15,19H,9-10,16-18H2,(H,28,30) |
| InChIKey | GWGSXZYAJBSJRO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |