C28H27N3O3 — CID 46056725
N-benzyl-4-cyano-N-[3-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]phenyl]benzamide (PubChem CID 46056725) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is N-benzyl-4-cyano-N-[3-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]phenyl]benzamide.
| Compound Name | N-benzyl-4-cyano-N-[3-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46056725 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-benzyl-4-cyano-N-[3-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]phenyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)N(Cc2ccccc2)c2cccc(CC(=O)NCC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C28H27N3O3/c29-18-21-11-13-24(14-12-21)28(33)31(20-22-6-2-1-3-7-22)25-9-4-8-23(16-25)17-27(32)30-19-26-10-5-15-34-26/h1-4,6-9,11-14,16,26H,5,10,15,17,19-20H2,(H,30,32) |
| InChIKey | DXJVTSAWSWIFDM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |