C29H29FN2O3 — CID 42859509
(E)-N-[(4-fluorophenyl)methyl]-N-[3-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 42859509) has the molecular formula C29H29FN2O3 and a molecular weight of 472.56 g/mol. Its IUPAC name is (E)-N-[(4-fluorophenyl)methyl]-N-[3-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(4-fluorophenyl)methyl]-N-[3-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42859509 |
| Molecular Formula | C29H29FN2O3 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (E)-N-[(4-fluorophenyl)methyl]-N-[3-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(Cc1cccc(N(Cc2ccc(F)cc2)C(=O)/C=C/c2ccccc2)c1)NCC1CCCO1 |
| InChI | InChI=1S/C29H29FN2O3/c30-25-14-11-23(12-15-25)21-32(29(34)16-13-22-6-2-1-3-7-22)26-9-4-8-24(18-26)19-28(33)31-20-27-10-5-17-35-27/h1-4,6-9,11-16,18,27H,5,10,17,19-21H2,(H,31,33)/b16-13+ |
| InChIKey | WYCRFSQIQAEUGG-DTQAZKPQSA-N |
| XLogP | 4.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|