C28H28N2O2 — CID 71957911
N-[3-[2-(cyclopropylamino)-2-oxoethyl]phenyl]-N-[(4-methylphenyl)methyl]-3-phenylprop-2-enamide (PubChem CID 71957911) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-[3-[2-(cyclopropylamino)-2-oxoethyl]phenyl]-N-[(4-methylphenyl)methyl]-3-phenylprop-2-enamide.
| Compound Name | N-[3-[2-(cyclopropylamino)-2-oxoethyl]phenyl]-N-[(4-methylphenyl)methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 71957911 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | N-[3-[2-(cyclopropylamino)-2-oxoethyl]phenyl]-N-[(4-methylphenyl)methyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc(CN(C(=O)C=Cc2ccccc2)c2cccc(CC(=O)NC3CC3)c2)cc1 |
| InChI | InChI=1S/C28H28N2O2/c1-21-10-12-23(13-11-21)20-30(28(32)17-14-22-6-3-2-4-7-22)26-9-5-8-24(18-26)19-27(31)29-25-15-16-25/h2-14,17-18,25H,15-16,19-20H2,1H3,(H,29,31) |
| InChIKey | LAUBWSZKPGFLCZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|