C28H30N2O2 — CID 71957751
N-[(3-methylphenyl)methyl]-N-[4-[2-oxo-2-(propylamino)ethyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 71957751) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-N-[4-[2-oxo-2-(propylamino)ethyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | N-[(3-methylphenyl)methyl]-N-[4-[2-oxo-2-(propylamino)ethyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 71957751 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-N-[4-[2-oxo-2-(propylamino)ethyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | CCCNC(=O)Cc1ccc(N(Cc2cccc(C)c2)C(=O)C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H30N2O2/c1-3-18-29-27(31)20-24-12-15-26(16-13-24)30(21-25-11-7-8-22(2)19-25)28(32)17-14-23-9-5-4-6-10-23/h4-17,19H,3,18,20-21H2,1-2H3,(H,29,31) |
| InChIKey | MOLKWNHCFOBZCK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|