C31H29N3O2 — CID 46052734
(E)-N-[(3-methylphenyl)methyl]-N-[4-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 46052734) has the molecular formula C31H29N3O2 and a molecular weight of 475.59 g/mol. Its IUPAC name is (E)-N-[(3-methylphenyl)methyl]-N-[4-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(3-methylphenyl)methyl]-N-[4-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 46052734 |
| Molecular Formula | C31H29N3O2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | (E)-N-[(3-methylphenyl)methyl]-N-[4-[2-oxo-2-(pyridin-4-ylmethylamino)ethyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | Cc1cccc(CN(C(=O)/C=C/c2ccccc2)c2ccc(CC(=O)NCc3ccncc3)cc2)c1 |
| InChI | InChI=1S/C31H29N3O2/c1-24-6-5-9-28(20-24)23-34(31(36)15-12-25-7-3-2-4-8-25)29-13-10-26(11-14-29)21-30(35)33-22-27-16-18-32-19-17-27/h2-20H,21-23H2,1H3,(H,33,35)/b15-12+ |
| InChIKey | KKFDEVOSPQFMMB-NTCAYCPXSA-N |
| XLogP | 5.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|