C31H26F2N2O2 — CID 46046274
(E)-N-[(3-fluorophenyl)methyl]-N-[4-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 46046274) has the molecular formula C31H26F2N2O2 and a molecular weight of 496.56 g/mol. Its IUPAC name is (E)-N-[(3-fluorophenyl)methyl]-N-[4-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(3-fluorophenyl)methyl]-N-[4-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 46046274 |
| Molecular Formula | C31H26F2N2O2 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | (E)-N-[(3-fluorophenyl)methyl]-N-[4-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(Cc1ccc(N(Cc2cccc(F)c2)C(=O)/C=C/c2ccccc2)cc1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C31H26F2N2O2/c32-27-14-9-25(10-15-27)21-34-30(36)20-24-11-16-29(17-12-24)35(22-26-7-4-8-28(33)19-26)31(37)18-13-23-5-2-1-3-6-23/h1-19H,20-22H2,(H,34,36)/b18-13+ |
| InChIKey | GOQBKXNWVMQRRV-QGOAFFKASA-N |
| XLogP | 6.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|