C32H28N2O4 — CID 71957930
N-[3-[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]phenyl]-N-benzyl-3-phenylprop-2-enamide (PubChem CID 71957930) has the molecular formula C32H28N2O4 and a molecular weight of 504.59 g/mol. Its IUPAC name is N-[3-[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]phenyl]-N-benzyl-3-phenylprop-2-enamide.
| Compound Name | N-[3-[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]phenyl]-N-benzyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 71957930 |
| Molecular Formula | C32H28N2O4 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | N-[3-[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]phenyl]-N-benzyl-3-phenylprop-2-enamide |
| SMILES | O=C(Cc1cccc(N(Cc2ccccc2)C(=O)C=Cc2ccccc2)c1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C32H28N2O4/c35-31(33-21-27-14-16-29-30(19-27)38-23-37-29)20-26-12-7-13-28(18-26)34(22-25-10-5-2-6-11-25)32(36)17-15-24-8-3-1-4-9-24/h1-19H,20-23H2,(H,33,35) |
| InChIKey | MHPKBJDHZFJNAE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|