C27H26FN3O4 — CID 46056381
N-(1,3-benzodioxol-5-ylmethyl)-2-[3-[(4-fluorophenyl)methyl-(prop-2-enylcarbamoyl)amino]phenyl]acetamide (PubChem CID 46056381) has the molecular formula C27H26FN3O4 and a molecular weight of 475.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[3-[(4-fluorophenyl)methyl-(prop-2-enylcarbamoyl)amino]phenyl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[3-[(4-fluorophenyl)methyl-(prop-2-enylcarbamoyl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 46056381 |
| Molecular Formula | C27H26FN3O4 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[3-[(4-fluorophenyl)methyl-(prop-2-enylcarbamoyl)amino]phenyl]acetamide |
| SMILES | C=CCNC(=O)N(Cc1ccc(F)cc1)c1cccc(CC(=O)NCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C27H26FN3O4/c1-2-12-29-27(33)31(17-19-6-9-22(28)10-7-19)23-5-3-4-20(13-23)15-26(32)30-16-21-8-11-24-25(14-21)35-18-34-24/h2-11,13-14H,1,12,15-18H2,(H,29,33)(H,30,32) |
| InChIKey | HJQROERLJOCXMT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|