C31H27FN2O2 — CID 71957937
N-benzyl-N-[3-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 71957937) has the molecular formula C31H27FN2O2 and a molecular weight of 478.57 g/mol. Its IUPAC name is N-benzyl-N-[3-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | N-benzyl-N-[3-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 71957937 |
| Molecular Formula | C31H27FN2O2 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-benzyl-N-[3-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(Cc1cccc(N(Cc2ccccc2)C(=O)C=Cc2ccccc2)c1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C31H27FN2O2/c32-28-17-14-25(15-18-28)22-33-30(35)21-27-12-7-13-29(20-27)34(23-26-10-5-2-6-11-26)31(36)19-16-24-8-3-1-4-9-24/h1-20H,21-23H2,(H,33,35) |
| InChIKey | LJTPVOIMACVNKV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|