C31H28N2O2 — CID 46056577
(E)-N-benzyl-N-[3-[2-(3-methylanilino)-2-oxoethyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 46056577) has the molecular formula C31H28N2O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (E)-N-benzyl-N-[3-[2-(3-methylanilino)-2-oxoethyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-benzyl-N-[3-[2-(3-methylanilino)-2-oxoethyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 46056577 |
| Molecular Formula | C31H28N2O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (E)-N-benzyl-N-[3-[2-(3-methylanilino)-2-oxoethyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | Cc1cccc(NC(=O)Cc2cccc(N(Cc3ccccc3)C(=O)/C=C/c3ccccc3)c2)c1 |
| InChI | InChI=1S/C31H28N2O2/c1-24-10-8-16-28(20-24)32-30(34)22-27-15-9-17-29(21-27)33(23-26-13-6-3-7-14-26)31(35)19-18-25-11-4-2-5-12-25/h2-21H,22-23H2,1H3,(H,32,34)/b19-18+ |
| InChIKey | LNNDJOZAVSCEGD-VHEBQXMUSA-N |
| XLogP | 6.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|