C28H30N2O2 — CID 42859330
(E)-N-benzyl-N-[3-[2-[methyl(propyl)amino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 42859330) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is (E)-N-benzyl-N-[3-[2-[methyl(propyl)amino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-benzyl-N-[3-[2-[methyl(propyl)amino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42859330 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (E)-N-benzyl-N-[3-[2-[methyl(propyl)amino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | CCCN(C)C(=O)Cc1cccc(N(Cc2ccccc2)C(=O)/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C28H30N2O2/c1-3-19-29(2)28(32)21-25-15-10-16-26(20-25)30(22-24-13-8-5-9-14-24)27(31)18-17-23-11-6-4-7-12-23/h4-18,20H,3,19,21-22H2,1-2H3/b18-17+ |
| InChIKey | FCIIOPFOEUJPGL-ISLYRVAYSA-N |
| XLogP | 5.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|