C33H31FN2O3 — CID 42859511
(E)-N-[(4-fluorophenyl)methyl]-N-[3-[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 42859511) has the molecular formula C33H31FN2O3 and a molecular weight of 522.62 g/mol. Its IUPAC name is (E)-N-[(4-fluorophenyl)methyl]-N-[3-[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(4-fluorophenyl)methyl]-N-[3-[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 42859511 |
| Molecular Formula | C33H31FN2O3 |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | (E)-N-[(4-fluorophenyl)methyl]-N-[3-[2-[2-(4-methoxyphenyl)ethylamino]-2-oxoethyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)Cc2cccc(N(Cc3ccc(F)cc3)C(=O)/C=C/c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C33H31FN2O3/c1-39-31-17-12-26(13-18-31)20-21-35-32(37)23-28-8-5-9-30(22-28)36(24-27-10-15-29(34)16-11-27)33(38)19-14-25-6-3-2-4-7-25/h2-19,22H,20-21,23-24H2,1H3,(H,35,37)/b19-14+ |
| InChIKey | SGHVLQAQFZPVRA-XMHGGMMESA-N |
| XLogP | 5.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|