C30H25N3O2 — CID 46056722
N-benzyl-4-cyano-N-[3-[2-(3-methylanilino)-2-oxoethyl]phenyl]benzamide (PubChem CID 46056722) has the molecular formula C30H25N3O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-benzyl-4-cyano-N-[3-[2-(3-methylanilino)-2-oxoethyl]phenyl]benzamide.
| Compound Name | N-benzyl-4-cyano-N-[3-[2-(3-methylanilino)-2-oxoethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46056722 |
| Molecular Formula | C30H25N3O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-benzyl-4-cyano-N-[3-[2-(3-methylanilino)-2-oxoethyl]phenyl]benzamide |
| SMILES | Cc1cccc(NC(=O)Cc2cccc(N(Cc3ccccc3)C(=O)c3ccc(C#N)cc3)c2)c1 |
| InChI | InChI=1S/C30H25N3O2/c1-22-7-5-11-27(17-22)32-29(34)19-25-10-6-12-28(18-25)33(21-24-8-3-2-4-9-24)30(35)26-15-13-23(20-31)14-16-26/h2-18H,19,21H2,1H3,(H,32,34) |
| InChIKey | VLKWCEUMVANCFL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |