C29H24FN3O4 — CID 42859630
N-[3-[2-(3-fluoroanilino)-2-oxoethyl]phenyl]-N-[(4-methylphenyl)methyl]-4-nitrobenzamide (PubChem CID 42859630) has the molecular formula C29H24FN3O4 and a molecular weight of 497.53 g/mol. Its IUPAC name is N-[3-[2-(3-fluoroanilino)-2-oxoethyl]phenyl]-N-[(4-methylphenyl)methyl]-4-nitrobenzamide.
| Compound Name | N-[3-[2-(3-fluoroanilino)-2-oxoethyl]phenyl]-N-[(4-methylphenyl)methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 42859630 |
| Molecular Formula | C29H24FN3O4 |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[3-[2-(3-fluoroanilino)-2-oxoethyl]phenyl]-N-[(4-methylphenyl)methyl]-4-nitrobenzamide |
| SMILES | Cc1ccc(CN(C(=O)c2ccc([N+](=O)[O-])cc2)c2cccc(CC(=O)Nc3cccc(F)c3)c2)cc1 |
| InChI | InChI=1S/C29H24FN3O4/c1-20-8-10-21(11-9-20)19-32(29(35)23-12-14-26(15-13-23)33(36)37)27-7-2-4-22(16-27)17-28(34)31-25-6-3-5-24(30)18-25/h2-16,18H,17,19H2,1H3,(H,31,34) |
| InChIKey | XOWGRCWYGCQBJQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|