C22H21NO3 — CID 11725248
3-[benzyl-[(4-methoxyphenyl)methyl]amino]benzoic acid (PubChem CID 11725248) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 3-[benzyl-[(4-methoxyphenyl)methyl]amino]benzoic acid.
| Compound Name | 3-[benzyl-[(4-methoxyphenyl)methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11725248 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 3-[benzyl-[(4-methoxyphenyl)methyl]amino]benzoic acid |
| SMILES | COc1ccc(CN(Cc2ccccc2)c2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C22H21NO3/c1-26-21-12-10-18(11-13-21)16-23(15-17-6-3-2-4-7-17)20-9-5-8-19(14-20)22(24)25/h2-14H,15-16H2,1H3,(H,24,25) |
| InChIKey | WSJHGIDXGSDRJD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |