C14H9Cl4NO — CID 91449149
4-chloro-N-[(2,4,6-trichlorophenyl)methyl]benzamide (PubChem CID 91449149) has the molecular formula C14H9Cl4NO and a molecular weight of 349.04 g/mol. Its IUPAC name is 4-chloro-N-[(2,4,6-trichlorophenyl)methyl]benzamide.
| Compound Name | 4-chloro-N-[(2,4,6-trichlorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 91449149 |
| Molecular Formula | C14H9Cl4NO |
| Molecular Weight | 349.04 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | 4-chloro-N-[(2,4,6-trichlorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1c(Cl)cc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H9Cl4NO/c15-9-3-1-8(2-4-9)14(20)19-7-11-12(17)5-10(16)6-13(11)18/h1-6H,7H2,(H,19,20) |
| InChIKey | VUEZOPBWQGOIOY-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.04 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |