C18H22ClN3O — CID 2805368
N-[[2,6-bis(dimethylamino)phenyl]methyl]-4-chlorobenzamide (PubChem CID 2805368) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is N-[[2,6-bis(dimethylamino)phenyl]methyl]-4-chlorobenzamide.
| Compound Name | N-[[2,6-bis(dimethylamino)phenyl]methyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 2805368 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[[2,6-bis(dimethylamino)phenyl]methyl]-4-chlorobenzamide |
| SMILES | CN(C)c1cccc(N(C)C)c1CNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClN3O/c1-21(2)16-6-5-7-17(22(3)4)15(16)12-20-18(23)13-8-10-14(19)11-9-13/h5-11H,12H2,1-4H3,(H,20,23) |
| InChIKey | RRRSRKPYXUVLMR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |