C15H15Cl2N3O — CID 61117248
3,5-diamino-N-[(2,4-dichlorophenyl)methyl]-N-methylbenzamide (PubChem CID 61117248) has the molecular formula C15H15Cl2N3O and a molecular weight of 324.21 g/mol. Its IUPAC name is 3,5-diamino-N-[(2,4-dichlorophenyl)methyl]-N-methylbenzamide.
| Compound Name | 3,5-diamino-N-[(2,4-dichlorophenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 61117248 |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 3,5-diamino-N-[(2,4-dichlorophenyl)methyl]-N-methylbenzamide |
| SMILES | CN(Cc1ccc(Cl)cc1Cl)C(=O)c1cc(N)cc(N)c1 |
| InChI | InChI=1S/C15H15Cl2N3O/c1-20(8-9-2-3-11(16)6-14(9)17)15(21)10-4-12(18)7-13(19)5-10/h2-7H,8,18-19H2,1H3 |
| InChIKey | BIWVKEFCOLKRPY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|