C28H23N3O3S — CID 3730795
2-cyano-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-naphthalen-1-ylprop-2-enamide (PubChem CID 3730795) has the molecular formula C28H23N3O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is 2-cyano-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | 2-cyano-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 3730795 |
| Molecular Formula | C28H23N3O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 2-cyano-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-naphthalen-1-ylprop-2-enamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(NC(=O)C(C#N)=Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C28H23N3O3S/c1-19-7-5-8-20(2)27(19)31-35(33,34)25-15-13-24(14-16-25)30-28(32)23(18-29)17-22-11-6-10-21-9-3-4-12-26(21)22/h3-17,31H,1-2H3,(H,30,32) |
| InChIKey | WWWPBYCRKQFDQI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|