C27H30N4O3S — CID 55864468
(Z)-2-cyano-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enamide (PubChem CID 55864468) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is (Z)-2-cyano-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55864468 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (Z)-2-cyano-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enamide |
| SMILES | CCCn1c(C)cc(/C=C(/C#N)C(=O)Nc2ccc(S(=O)(=O)Nc3c(C)cccc3C)cc2)c1C |
| InChI | InChI=1S/C27H30N4O3S/c1-6-14-31-20(4)15-22(21(31)5)16-23(17-28)27(32)29-24-10-12-25(13-11-24)35(33,34)30-26-18(2)8-7-9-19(26)3/h7-13,15-16,30H,6,14H2,1-5H3,(H,29,32)/b23-16- |
| InChIKey | PTDFVUFXRLXCRJ-KQWNVCNZSA-N |
| XLogP | 5.48 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|