C19H19F2N3O — CID 26360466
(E)-2-cyano-N-(2,5-difluorophenyl)-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enamide (PubChem CID 26360466) has the molecular formula C19H19F2N3O and a molecular weight of 343.38 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,5-difluorophenyl)-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,5-difluorophenyl)-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 26360466 |
| Molecular Formula | C19H19F2N3O |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (E)-2-cyano-N-(2,5-difluorophenyl)-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enamide |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)Nc2cc(F)ccc2F)c1C |
| InChI | InChI=1S/C19H19F2N3O/c1-4-7-24-12(2)8-14(13(24)3)9-15(11-22)19(25)23-18-10-16(20)5-6-17(18)21/h5-6,8-10H,4,7H2,1-3H3,(H,23,25)/b15-9+ |
| InChIKey | QKGBDFWPJZHIKY-OQLLNIDSSA-N |
| XLogP | 4.34 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|