C27H21N3O4S — CID 5437836
(Z)-2-cyano-3-[2-(naphthalen-1-ylmethoxy)phenyl]-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 5437836) has the molecular formula C27H21N3O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2-(naphthalen-1-ylmethoxy)phenyl]-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2-(naphthalen-1-ylmethoxy)phenyl]-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5437836 |
| Molecular Formula | C27H21N3O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | (Z)-2-cyano-3-[2-(naphthalen-1-ylmethoxy)phenyl]-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccccc1OCc1cccc2ccccc12)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C27H21N3O4S/c28-17-22(27(31)30-23-12-14-24(15-13-23)35(29,32)33)16-20-7-2-4-11-26(20)34-18-21-9-5-8-19-6-1-3-10-25(19)21/h1-16H,18H2,(H,30,31)(H2,29,32,33)/b22-16- |
| InChIKey | REBMZHPUSFUFEG-JWGURIENSA-N |
| XLogP | 4.61 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|