C24H16ClN2O4- — CID 2354611
3-[[(E)-3-[2-[(2-chlorophenyl)methoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 2354611) has the molecular formula C24H16ClN2O4- and a molecular weight of 431.86 g/mol. Its IUPAC name is 3-[[(E)-3-[2-[(2-chlorophenyl)methoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | 3-[[(E)-3-[2-[(2-chlorophenyl)methoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 2354611 |
| Molecular Formula | C24H16ClN2O4- |
| Molecular Weight | 431.86 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 3-[[(E)-3-[2-[(2-chlorophenyl)methoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | N#C/C(=C\c1ccccc1OCc1ccccc1Cl)C(=O)Nc1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C24H17ClN2O4/c25-21-10-3-1-7-18(21)15-31-22-11-4-2-6-16(22)12-19(14-26)23(28)27-20-9-5-8-17(13-20)24(29)30/h1-13H,15H2,(H,27,28)(H,29,30)/p-1/b19-12+ |
| InChIKey | DRTKQPHIRJGRLZ-XDHOZWIPSA-M |
| XLogP | 3.83 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.86 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|