C28H17N2O5- — CID 2467230
3-[[(E)-2-cyano-3-[2-(naphthalene-1-carbonyloxy)phenyl]prop-2-enoyl]amino]benzoate (PubChem CID 2467230) has the molecular formula C28H17N2O5- and a molecular weight of 461.45 g/mol. Its IUPAC name is 3-[[(E)-2-cyano-3-[2-(naphthalene-1-carbonyloxy)phenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | 3-[[(E)-2-cyano-3-[2-(naphthalene-1-carbonyloxy)phenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 2467230 |
| Molecular Formula | C28H17N2O5- |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 3-[[(E)-2-cyano-3-[2-(naphthalene-1-carbonyloxy)phenyl]prop-2-enoyl]amino]benzoate |
| SMILES | N#C/C(=C\c1ccccc1OC(=O)c1cccc2ccccc12)C(=O)Nc1cccc(C(=O)[O-])c1 |
| InChI | InChI=1S/C28H18N2O5/c29-17-21(26(31)30-22-11-5-10-20(16-22)27(32)33)15-19-8-2-4-14-25(19)35-28(34)24-13-6-9-18-7-1-3-12-23(18)24/h1-16H,(H,30,31)(H,32,33)/p-1/b21-15+ |
| InChIKey | HJVMHMIZPKKCTK-RCCKNPSSSA-M |
| XLogP | 3.97 |
| TPSA | 119.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|