C29H20N2O6 — CID 3967332
3-[[3-[2-[(4-carboxyphenyl)methoxy]naphthalen-1-yl]-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 3967332) has the molecular formula C29H20N2O6 and a molecular weight of 492.49 g/mol. Its IUPAC name is 3-[[3-[2-[(4-carboxyphenyl)methoxy]naphthalen-1-yl]-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[3-[2-[(4-carboxyphenyl)methoxy]naphthalen-1-yl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 3967332 |
| Molecular Formula | C29H20N2O6 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 3-[[3-[2-[(4-carboxyphenyl)methoxy]naphthalen-1-yl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | N#CC(=Cc1c(OCc2ccc(C(=O)O)cc2)ccc2ccccc12)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C29H20N2O6/c30-16-22(27(32)31-23-6-3-5-21(14-23)29(35)36)15-25-24-7-2-1-4-19(24)12-13-26(25)37-17-18-8-10-20(11-9-18)28(33)34/h1-15H,17H2,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | SULMFKNZZXDTCE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|