C24H15ClI2N2O4 — CID 99693619
3-[[(Z)-3-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 99693619) has the molecular formula C24H15ClI2N2O4 and a molecular weight of 684.66 g/mol. Its IUPAC name is 3-[[(Z)-3-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-3-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 99693619 |
| Molecular Formula | C24H15ClI2N2O4 |
| Molecular Weight | 684.66 g/mol |
| Exact Mass | 683.88 |
| IUPAC Name | 3-[[(Z)-3-[4-[(4-chlorophenyl)methoxy]-3,5-diiodophenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | N#C/C(=C/c1cc(I)c(OCc2ccc(Cl)cc2)c(I)c1)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H15ClI2N2O4/c25-18-6-4-14(5-7-18)13-33-22-20(26)9-15(10-21(22)27)8-17(12-28)23(30)29-19-3-1-2-16(11-19)24(31)32/h1-11H,13H2,(H,29,30)(H,31,32)/b17-8- |
| InChIKey | HYZJOIRNOHFITK-IUXPMGMMSA-N |
| XLogP | 6.37 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.66 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|