C29H32N2O3S — CID 108759486
(Z)-N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-2,3-diphenylprop-2-enamide (PubChem CID 108759486) has the molecular formula C29H32N2O3S and a molecular weight of 488.65 g/mol. Its IUPAC name is (Z)-N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 108759486 |
| Molecular Formula | C29H32N2O3S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (Z)-N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-2,3-diphenylprop-2-enamide |
| SMILES | O=C(NCCc1ccc(S(=O)(=O)N2CCCCCC2)cc1)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32N2O3S/c32-29(28(26-13-7-4-8-14-26)23-25-11-5-3-6-12-25)30-20-19-24-15-17-27(18-16-24)35(33,34)31-21-9-1-2-10-22-31/h3-8,11-18,23H,1-2,9-10,19-22H2,(H,30,32)/b28-23- |
| InChIKey | MOJZFIDAPCWKCP-NFFVHWSESA-N |
| XLogP | 5.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|