C19H29N3O5S — CID 30126490
N-(3-methoxypropyl)-N'-[2-(4-piperidin-1-ylsulfonylphenyl)ethyl]oxamide (PubChem CID 30126490) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N'-[2-(4-piperidin-1-ylsulfonylphenyl)ethyl]oxamide.
| Compound Name | N-(3-methoxypropyl)-N'-[2-(4-piperidin-1-ylsulfonylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 30126490 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-(3-methoxypropyl)-N'-[2-(4-piperidin-1-ylsulfonylphenyl)ethyl]oxamide |
| SMILES | COCCCNC(=O)C(=O)NCCc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H29N3O5S/c1-27-15-5-11-20-18(23)19(24)21-12-10-16-6-8-17(9-7-16)28(25,26)22-13-3-2-4-14-22/h6-9H,2-5,10-15H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | RKBFRODHUGGHQW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|