C24H31N3O6S — CID 17248888
N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(4-piperidin-1-ylsulfonylphenyl)methyl]oxamide (PubChem CID 17248888) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(4-piperidin-1-ylsulfonylphenyl)methyl]oxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(4-piperidin-1-ylsulfonylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 17248888 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N'-[(4-piperidin-1-ylsulfonylphenyl)methyl]oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)NCc2ccc(S(=O)(=O)N3CCCCC3)cc2)cc1OC |
| InChI | InChI=1S/C24H31N3O6S/c1-32-21-11-8-18(16-22(21)33-2)12-13-25-23(28)24(29)26-17-19-6-9-20(10-7-19)34(30,31)27-14-4-3-5-15-27/h6-11,16H,3-5,12-15,17H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | ROTMQWMRTJSMGI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|