C17H25N3O4S — CID 17248838
N-[(4-piperidin-1-ylsulfonylphenyl)methyl]-N'-propan-2-yloxamide (PubChem CID 17248838) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[(4-piperidin-1-ylsulfonylphenyl)methyl]-N'-propan-2-yloxamide.
| Compound Name | N-[(4-piperidin-1-ylsulfonylphenyl)methyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 17248838 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[(4-piperidin-1-ylsulfonylphenyl)methyl]-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)NCc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H25N3O4S/c1-13(2)19-17(22)16(21)18-12-14-6-8-15(9-7-14)25(23,24)20-10-4-3-5-11-20/h6-9,13H,3-5,10-12H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | UBRTYTAYDWWWCD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|