C19H24N2O6S2 — CID 17248759
3,4-dimethoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzenesulfonamide (PubChem CID 17248759) has the molecular formula C19H24N2O6S2 and a molecular weight of 440.54 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 17248759 |
| Molecular Formula | C19H24N2O6S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 3,4-dimethoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccc(S(=O)(=O)N3CCCC3)cc2)cc1OC |
| InChI | InChI=1S/C19H24N2O6S2/c1-26-18-10-9-17(13-19(18)27-2)28(22,23)20-14-15-5-7-16(8-6-15)29(24,25)21-11-3-4-12-21/h5-10,13,20H,3-4,11-12,14H2,1-2H3 |
| InChIKey | BSRWVHWSMREYOO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |