C18H21ClN2O5S2 — CID 17248763
3-chloro-4-methoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzenesulfonamide (PubChem CID 17248763) has the molecular formula C18H21ClN2O5S2 and a molecular weight of 444.96 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-methoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 17248763 |
| Molecular Formula | C18H21ClN2O5S2 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 3-chloro-4-methoxy-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccc(S(=O)(=O)N3CCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O5S2/c1-26-18-9-8-16(12-17(18)19)27(22,23)20-13-14-4-6-15(7-5-14)28(24,25)21-10-2-3-11-21/h4-9,12,20H,2-3,10-11,13H2,1H3 |
| InChIKey | BHTGHWLMCWFCII-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |