C14H21ClN2O5S2 — CID 110287612
3-chloro-4-methoxy-N-(2-piperidin-1-ylsulfonylethyl)benzenesulfonamide (PubChem CID 110287612) has the molecular formula C14H21ClN2O5S2 and a molecular weight of 396.92 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-(2-piperidin-1-ylsulfonylethyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-methoxy-N-(2-piperidin-1-ylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110287612 |
| Molecular Formula | C14H21ClN2O5S2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 3-chloro-4-methoxy-N-(2-piperidin-1-ylsulfonylethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCS(=O)(=O)N2CCCCC2)cc1Cl |
| InChI | InChI=1S/C14H21ClN2O5S2/c1-22-14-6-5-12(11-13(14)15)24(20,21)16-7-10-23(18,19)17-8-3-2-4-9-17/h5-6,11,16H,2-4,7-10H2,1H3 |
| InChIKey | AKMBYUJTYPBCKI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |