C14H20N2O6S2 — CID 110287605
N-(2-piperidin-1-ylsulfonylethyl)-1,3-benzodioxole-5-sulfonamide (PubChem CID 110287605) has the molecular formula C14H20N2O6S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-(2-piperidin-1-ylsulfonylethyl)-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-(2-piperidin-1-ylsulfonylethyl)-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110287605 |
| Molecular Formula | C14H20N2O6S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-(2-piperidin-1-ylsulfonylethyl)-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(NCCS(=O)(=O)N1CCCCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H20N2O6S2/c17-23(18,16-7-2-1-3-8-16)9-6-15-24(19,20)12-4-5-13-14(10-12)22-11-21-13/h4-5,10,15H,1-3,6-9,11H2 |
| InChIKey | LAJFHGJQRLFLQU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |