C14H16N2O7S2 — CID 110345927
N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 110345927) has the molecular formula C14H16N2O7S2 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110345927 |
| Molecular Formula | C14H16N2O7S2 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(CCNS(=O)(=O)c1ccc2c(c1)OCO2)NCc1ccco1 |
| InChI | InChI=1S/C14H16N2O7S2/c17-24(18,16-9-11-2-1-6-21-11)7-5-15-25(19,20)12-3-4-13-14(8-12)23-10-22-13/h1-4,6,8,15-16H,5,7,9-10H2 |
| InChIKey | JRFITKWENLNSML-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |