C14H15NO4S — CID 110705597
N-(furan-2-ylmethyl)-3,4-dihydro-2H-chromene-6-sulfonamide (PubChem CID 110705597) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3,4-dihydro-2H-chromene-6-sulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-3,4-dihydro-2H-chromene-6-sulfonamide |
|---|---|
| PubChem CID | 110705597 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-(furan-2-ylmethyl)-3,4-dihydro-2H-chromene-6-sulfonamide |
| SMILES | O=S(=O)(NCc1ccco1)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C14H15NO4S/c16-20(17,15-10-12-4-2-7-18-12)13-5-6-14-11(9-13)3-1-8-19-14/h2,4-7,9,15H,1,3,8,10H2 |
| InChIKey | IMCOCBQHWWEFLN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |