C16H18N2O6S2 — CID 110287737
N-[2-[methyl(phenyl)sulfamoyl]ethyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 110287737) has the molecular formula C16H18N2O6S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-[2-[methyl(phenyl)sulfamoyl]ethyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[2-[methyl(phenyl)sulfamoyl]ethyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110287737 |
| Molecular Formula | C16H18N2O6S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N-[2-[methyl(phenyl)sulfamoyl]ethyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)CCNS(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H18N2O6S2/c1-18(13-5-3-2-4-6-13)25(19,20)10-9-17-26(21,22)14-7-8-15-16(11-14)24-12-23-15/h2-8,11,17H,9-10,12H2,1H3 |
| InChIKey | YSZJVSKSJAXEDD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |