C17H18ClNO4S — CID 110409301
N-[4-(2-chlorophenyl)butyl]-1,3-benzodioxole-5-sulfonamide (PubChem CID 110409301) has the molecular formula C17H18ClNO4S and a molecular weight of 367.85 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)butyl]-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[4-(2-chlorophenyl)butyl]-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110409301 |
| Molecular Formula | C17H18ClNO4S |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | N-[4-(2-chlorophenyl)butyl]-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(NCCCCc1ccccc1Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H18ClNO4S/c18-15-7-2-1-5-13(15)6-3-4-10-19-24(20,21)14-8-9-16-17(11-14)23-12-22-16/h1-2,5,7-9,11,19H,3-4,6,10,12H2 |
| InChIKey | WZPKTLJJQWOHOO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|