C19H20Cl2N2O5S — CID 36804440
N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[(3,4-dichlorophenyl)sulfonylamino]butanamide (PubChem CID 36804440) has the molecular formula C19H20Cl2N2O5S and a molecular weight of 459.35 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[(3,4-dichlorophenyl)sulfonylamino]butanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[(3,4-dichlorophenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 36804440 |
| Molecular Formula | C19H20Cl2N2O5S |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-[(3,4-dichlorophenyl)sulfonylamino]butanamide |
| SMILES | O=C(CCCNS(=O)(=O)c1ccc(Cl)c(Cl)c1)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20Cl2N2O5S/c20-15-5-4-14(11-16(15)21)29(25,26)23-8-1-2-19(24)22-9-7-13-3-6-17-18(10-13)28-12-27-17/h3-6,10-11,23H,1-2,7-9,12H2,(H,22,24) |
| InChIKey | XUBUYAITLYTLSQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|