C14H18N2O5S2 — CID 110345911
N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-4-methylbenzenesulfonamide (PubChem CID 110345911) has the molecular formula C14H18N2O5S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110345911 |
| Molecular Formula | C14H18N2O5S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCS(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C14H18N2O5S2/c1-12-4-6-14(7-5-12)23(19,20)15-8-10-22(17,18)16-11-13-3-2-9-21-13/h2-7,9,15-16H,8,10-11H2,1H3 |
| InChIKey | KSTODOSMQHKTKJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |