C15H18N2O4S — CID 110345848
N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-2-methylbenzamide (PubChem CID 110345848) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-2-methylbenzamide.
| Compound Name | N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 110345848 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NCCS(=O)(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H18N2O4S/c1-12-5-2-3-7-14(12)15(18)16-8-10-22(19,20)17-11-13-6-4-9-21-13/h2-7,9,17H,8,10-11H2,1H3,(H,16,18) |
| InChIKey | XNIVMSIVLHUFQS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |