C17H22N2O5S — CID 110345873
N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-4-phenoxybutanamide (PubChem CID 110345873) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-4-phenoxybutanamide.
| Compound Name | N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 110345873 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[2-(furan-2-ylmethylsulfamoyl)ethyl]-4-phenoxybutanamide |
| SMILES | O=C(CCCOc1ccccc1)NCCS(=O)(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H22N2O5S/c20-17(9-5-12-23-15-6-2-1-3-7-15)18-10-13-25(21,22)19-14-16-8-4-11-24-16/h1-4,6-8,11,19H,5,9-10,12-14H2,(H,18,20) |
| InChIKey | QKNWLSFCFZQFBK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|