C14H16FNO4S — CID 16884354
3-(4-fluorophenoxy)-N-(furan-2-ylmethyl)propane-1-sulfonamide (PubChem CID 16884354) has the molecular formula C14H16FNO4S and a molecular weight of 313.35 g/mol. Its IUPAC name is 3-(4-fluorophenoxy)-N-(furan-2-ylmethyl)propane-1-sulfonamide.
| Compound Name | 3-(4-fluorophenoxy)-N-(furan-2-ylmethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 16884354 |
| Molecular Formula | C14H16FNO4S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 3-(4-fluorophenoxy)-N-(furan-2-ylmethyl)propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCOc1ccc(F)cc1)NCc1ccco1 |
| InChI | InChI=1S/C14H16FNO4S/c15-12-4-6-13(7-5-12)19-9-2-10-21(17,18)16-11-14-3-1-8-20-14/h1,3-8,16H,2,9-11H2 |
| InChIKey | MFLXANVMPCAJQO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|